(4-methanesulfonylphenyl)-N,N-dimethyl-amine
(4-methanesulfonylphenyl)-N,N-dimethyl-amine structure
|
Common Name | (4-methanesulfonylphenyl)-N,N-dimethyl-amine | ||
|---|---|---|---|---|
| CAS Number | 33599-22-3 | Molecular Weight | 199.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-methanesulfonylphenyl)-N,N-dimethyl-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13NO2S |
|---|---|
| Molecular Weight | 199.27000 |
| Exact Mass | 199.06700 |
| PSA | 45.76000 |
| LogP | 2.23690 |
| InChIKey | HRQDMLGFRSFYHZ-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(S(C)(=O)=O)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
CAS#:455-15-2
CAS#:90357-06-5
CAS#:51601-26-4![[1,1'-Biphenyl]-4-amine,N,N-dimethyl structure](https://image.chemsrc.com/caspic/481/1137-79-7.png)
CAS#:1137-79-7This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Methylsulfon-N.N-dimethyl-anilin |
| 4-Dimethylamino-1-methylsulfonylbenzol |
| Methyl-(4-dimethylamino-phenyl)-sulfon |
| N,N-dimethylaniline-4-methyl sulfone |
| 4-Methansulfonyl-N,N-dimethyl-anilin |
| 4-methanesulfonyl-N,N-dimethyl-aniline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (4-methanesulfonylphenyl)-N,N-dimethyl-amine? |
| A: CAS number of (4-methanesulfonylphenyl)-N,N-dimethyl-amine is 33599-22-3. |
| Q: What is the Chinese name of 33599-22-3? |
| A: Chinese name of 33599-22-3 is 33599-22-3. |
| Q: What English synonyms does (4-methanesulfonylphenyl)-N,N-dimethyl-amine have? |
| A: English synonyms of (4-methanesulfonylphenyl)-N,N-dimethyl-amine: 4-Methylsulfon-N.N-dimethyl-anilin, 4-Dimethylamino-1-methylsulfonylbenzol, Methyl-(4-dimethylamino-phenyl)-sulfon, N,N-dimethylaniline-4-methyl sulfone, 4-Methansulfonyl-N,N-dimethyl-anilin, 4-methanesulfonyl-N,N-dimethyl-aniline. |
| Q: What is the LogP of (4-methanesulfonylphenyl)-N,N-dimethyl-amine? |
| A: LogP of (4-methanesulfonylphenyl)-N,N-dimethyl-amine is 2.23690. |
| Q: What is the English name of (4-methanesulfonylphenyl)-N,N-dimethyl-amine? |
| A: The English name of (4-methanesulfonylphenyl)-N,N-dimethyl-amine is (4-methanesulfonylphenyl)-N,N-dimethyl-amine. |
| Q: What is the InChIKey of (4-methanesulfonylphenyl)-N,N-dimethyl-amine? |
| A: InChIKey of (4-methanesulfonylphenyl)-N,N-dimethyl-amine is HRQDMLGFRSFYHZ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of (4-methanesulfonylphenyl)-N,N-dimethyl-amine? |
| A: Polar surface area (PSA) of (4-methanesulfonylphenyl)-N,N-dimethyl-amine is 45.76000. |
| Q: What are the downstream products of (4-methanesulfonylphenyl)-N,N-dimethyl-amine? |
| A: Related downstream products(CAS) of (4-methanesulfonylphenyl)-N,N-dimethyl-amine: 455-15-2;90357-06-5;51601-26-4;1137-79-7. |
| Q: What is the molecular weight of (4-methanesulfonylphenyl)-N,N-dimethyl-amine? |
| A: Molecular weight of (4-methanesulfonylphenyl)-N,N-dimethyl-amine is 199.27000. |
| Q: What is the SMILES notation of (4-methanesulfonylphenyl)-N,N-dimethyl-amine? |
| A: SMILES notation of (4-methanesulfonylphenyl)-N,N-dimethyl-amine is CN(C)c1ccc(S(C)(=O)=O)cc1. |