2-Pentanone,3,3,4,4,5,5,5-heptafluoro-1-(2-pyridinyl) structure
|
Common Name | 2-Pentanone,3,3,4,4,5,5,5-heptafluoro-1-(2-pyridinyl) | ||
|---|---|---|---|---|
| CAS Number | 336-60-7 | Molecular Weight | 289.15000 | |
| Density | 1.442g/cm3 | Boiling Point | 211.1ºC at 760mmHg | |
| Molecular Formula | C10H6F7NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 81.5ºC | |
| Name | 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one |
|---|
| Density | 1.442g/cm3 |
|---|---|
| Boiling Point | 211.1ºC at 760mmHg |
| Molecular Formula | C10H6F7NO |
| Molecular Weight | 289.15000 |
| Flash Point | 81.5ºC |
| Exact Mass | 289.03400 |
| PSA | 29.96000 |
| LogP | 3.02610 |
| Index of Refraction | 1.402 |
| InChIKey | UMAGRURZHCBKFO-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccn1)C(F)(F)C(F)(F)C(F)(F)F |
|
~%
2-Pentanone,3,3... CAS#:336-60-7 |
| Literature: McGrath; Levine Journal of the American Chemical Society, 1955 , vol. 77, p. 3656 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|