2-Pentanone,3,3,4,4,5,5,5-heptafluoro-1-(2-pyridinyl)
2-Pentanone,3,3,4,4,5,5,5-heptafluoro-1-(2-pyridinyl) structure
|
Common Name | 2-Pentanone,3,3,4,4,5,5,5-heptafluoro-1-(2-pyridinyl) | ||
|---|---|---|---|---|
| CAS Number | 336-60-7 | Molecular Weight | 289.15000 | |
| Density | 1.442g/cm3 | Boiling Point | 211.1ºC at 760mmHg | |
| Molecular Formula | C10H6F7NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 81.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.442g/cm3 |
|---|---|
| Boiling Point | 211.1ºC at 760mmHg |
| Molecular Formula | C10H6F7NO |
| Molecular Weight | 289.15000 |
| Flash Point | 81.5ºC |
| Exact Mass | 289.03400 |
| PSA | 29.96000 |
| LogP | 3.02610 |
| Index of Refraction | 1.402 |
| InChIKey | UMAGRURZHCBKFO-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccn1)C(F)(F)C(F)(F)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-Pentanone,3,3... CAS#:336-60-7 |
| Literature: McGrath; Levine Journal of the American Chemical Society, 1955 , vol. 77, p. 3656 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one? |
| A: InChIKey of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one is UMAGRURZHCBKFO-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 336-60-7? |
| A: Chinese name of 336-60-7 is 336-60-7. |
| Q: What is the English name of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one? |
| A: The English name of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one is 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one. |
| Q: What is the SMILES notation of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one? |
| A: SMILES notation of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one is O=C(Cc1ccccn1)C(F)(F)C(F)(F)C(F)(F)F. |
| Q: What is the boiling point of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one? |
| A: Boiling point of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one is 211.1ºC at 760mmHg. |
| Q: What are the upstream materials of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one? |
| A: Related upstream materials(CAS) of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one: 109-06-8. |
| Q: What is the molecular formula of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one? |
| A: Molecular formula of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one is C10H6F7NO. |
| Q: What is the CAS number of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one? |
| A: CAS number of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one is 336-60-7. |
| Q: What is the LogP of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one? |
| A: LogP of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one is 3.02610. |
| Q: What is the molecular weight of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one? |
| A: Molecular weight of 3,3,4,4,5,5,5-heptafluoro-1-pyridin-2-ylpentan-2-one is 289.15000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |