trifluoromethylmesitylene
trifluoromethylmesitylene structure
|
Common Name | trifluoromethylmesitylene | ||
|---|---|---|---|---|
| CAS Number | 3360-56-3 | Molecular Weight | 188.19000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11F3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trifluoromethylmesitylene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11F3 |
|---|---|
| Molecular Weight | 188.19000 |
| Exact Mass | 188.08100 |
| LogP | 3.63060 |
| InChIKey | VDEYYSZYUVCKJS-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(F)(F)F)c(C)c1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4,6-trimethyltrifluoromethylbenzene |
| 1,3,5-trimethyl-2-(trifluoromethyl)-benzene |
| 1,2,4-trimethyl-5-(trifluoromethyl)benzene |
| 1,3,5-trimethyl-2-(trifluoromethyl)benzene |
| 1,3,5-trimethyl-2-trifluoromethylbenzene |
| 1-(trifluoromethyl)-2,4,6-trimethylbenzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of trifluoromethylmesitylene? |
| A: SMILES notation of trifluoromethylmesitylene is Cc1cc(C)c(C(F)(F)F)c(C)c1. |
| Q: What is the LogP of trifluoromethylmesitylene? |
| A: LogP of trifluoromethylmesitylene is 3.63060. |
| Q: What is the Chinese name of 3360-56-3? |
| A: Chinese name of 3360-56-3 is 3360-56-3. |
| Q: What English synonyms does trifluoromethylmesitylene have? |
| A: English synonyms of trifluoromethylmesitylene: 2,4,6-trimethyltrifluoromethylbenzene, 1,3,5-trimethyl-2-(trifluoromethyl)-benzene, 1,2,4-trimethyl-5-(trifluoromethyl)benzene, 1,3,5-trimethyl-2-(trifluoromethyl)benzene, 1,3,5-trimethyl-2-trifluoromethylbenzene, 1-(trifluoromethyl)-2,4,6-trimethylbenzene. |
| Q: What is the CAS number of trifluoromethylmesitylene? |
| A: CAS number of trifluoromethylmesitylene is 3360-56-3. |
| Q: What is the molecular formula of trifluoromethylmesitylene? |
| A: Molecular formula of trifluoromethylmesitylene is C10H11F3. |
| Q: What is the InChIKey of trifluoromethylmesitylene? |
| A: InChIKey of trifluoromethylmesitylene is VDEYYSZYUVCKJS-UHFFFAOYSA-N. |
| Q: What is the English name of trifluoromethylmesitylene? |
| A: The English name of trifluoromethylmesitylene is trifluoromethylmesitylene. |
| Q: What is the molecular weight of trifluoromethylmesitylene? |
| A: Molecular weight of trifluoromethylmesitylene is 188.19000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |