2-amino-3-(6-methoxy-1H-indol-3-yl)propanoic acid structure
|
Common Name | 2-amino-3-(6-methoxy-1H-indol-3-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 33600-67-8 | Molecular Weight | 234.25100 | |
| Density | N/A | Boiling Point | 478.3±45.0°C at 760 mmHg | |
| Molecular Formula | C12H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-3-(6-methoxy-1H-indol-3-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 478.3±45.0°C at 760 mmHg |
|---|---|
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25100 |
| Exact Mass | 234.10000 |
| PSA | 88.34000 |
| LogP | 1.83120 |
| InChIKey | ASMBUJRMSWTSLE-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(CC(N)C(=O)O)c[nH]c2c1 |
| HS Code | 2933990090 |
|---|
|
~%
2-amino-3-(6-me... CAS#:33600-67-8 |
| Literature: E. Lilly and Co. Patent: US2621187 , 1952 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-methoxy-tryptophan |