2,5-ditert-butyl-3-chlorocyclohexa-2,5-diene-1,4-dione structure
|
Common Name | 2,5-ditert-butyl-3-chlorocyclohexa-2,5-diene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 33611-70-0 | Molecular Weight | 254.75200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-ditert-butyl-3-chlorocyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H19ClO2 |
|---|---|
| Molecular Weight | 254.75200 |
| Exact Mass | 254.10700 |
| PSA | 34.14000 |
| LogP | 3.64970 |
| InChIKey | ZSOPDZVUJBQDBI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=O)C(C(C)(C)C)=C(Cl)C1=O |
|
~%
2,5-ditert-buty... CAS#:33611-70-0 |
| Literature: Moore,H.W.; Weyler,W. Journal of the American Chemical Society, 1971 , vol. 93, # 11 p. 2812 - 2813 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2-Chlor-3,6-di-tert.-butyl-1,4-benzochinon |
| 2,5-ditert-butyl-3-chlorobenzo-1,4-quinone |
| 3-Chlor-2.5-di-tert.butyl-1.4-benzochinon |