2,5-Ditert-butyl-5,6-dichloro-2-cyclohexene-1,4-dione structure
|
Common Name | 2,5-Ditert-butyl-5,6-dichloro-2-cyclohexene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 33611-72-2 | Molecular Weight | 291.21300 | |
| Density | 1.15g/cm3 | Boiling Point | 354ºC at 760 mmHg | |
| Molecular Formula | C14H20Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.5ºC | |
| Name | 2,5-ditert-butyl-5,6-dichlorocyclohex-2-ene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 354ºC at 760 mmHg |
| Molecular Formula | C14H20Cl2O2 |
| Molecular Weight | 291.21300 |
| Flash Point | 149.5ºC |
| Exact Mass | 290.08400 |
| PSA | 34.14000 |
| LogP | 3.74180 |
| Index of Refraction | 1.5 |
| InChIKey | JSACLUOJBWRMBY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=O)C(Cl)(C(C)(C)C)C(Cl)C1=O |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,5-Di-tert.-butyl-5,6-dichlor-1,4-cyclohexendion |
| 2,5-Ditert-butyl-5,6-dichloro-2-cyclohexene-1,4-dione |