2,4-Bis[(trimethylsilyl)oxy]benzaldehyde structure
|
Common Name | 2,4-Bis[(trimethylsilyl)oxy]benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 33617-38-8 | Molecular Weight | 282.48300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22O3Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-bis(trimethylsilyloxy)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H22O3Si2 |
|---|---|
| Molecular Weight | 282.48300 |
| Exact Mass | 282.11100 |
| PSA | 35.53000 |
| LogP | 3.92650 |
| InChIKey | UIOLBHGUVXPTDV-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)Oc1ccc(C=O)c(O[Si](C)(C)C)c1 |
| HS Code | 2931900090 |
|---|
|
~%
2,4-Bis[(trimet... CAS#:33617-38-8 |
| Literature: Reimann,E. Justus Liebigs Annalen der Chemie, 1971 , vol. 750, p. 109 - 127 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2,4-Bis[(trimethylsilyl)oxy]benzaldehyde |
| Benzaldehyde,2,4-bis(trimethylsiloxy) |