naphthalen-2-yl 2-methylpropanoate structure
|
Common Name | naphthalen-2-yl 2-methylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 33617-65-1 | Molecular Weight | 214.26000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | naphthalen-2-yl 2-methylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14O2 |
|---|---|
| Molecular Weight | 214.26000 |
| Exact Mass | 214.09900 |
| PSA | 26.30000 |
| LogP | 3.40120 |
| InChIKey | RVFNBABJYWYXFR-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)Oc1ccc2ccccc2c1 |
|
~10%
naphthalen-2-yl... CAS#:33617-65-1 |
| Literature: Chakraborti, Asit K.; Sharma, Lalima; Gulhane, Rajesh; Shivani Tetrahedron, 2003 , vol. 59, # 39 p. 7661 - 7668 |
|
~%
naphthalen-2-yl... CAS#:33617-65-1 |
| Literature: Harfenist; Baltzly Journal of the American Chemical Society, 1947 , vol. 69, p. 362 |
|
~%
naphthalen-2-yl... CAS#:33617-65-1 |
| Literature: Einhorn; Hollandt Justus Liebigs Annalen der Chemie, 1898 , vol. 301, p. 104 |
| 2-Methylpropionic acid,2-naphthyl ester |
| 2-naphthyl 2-methylpropanoate |
| 2-Isobutyryloxy-naphthalin |
| 2-naphthyl 2,2-dimethylacetate |