4-((e)-2-[4-(diethylamino)phenyl]ethenyl)-1-[3-(triethylammonio)propyl]pyridinium dibromide structure
|
Common Name | 4-((e)-2-[4-(diethylamino)phenyl]ethenyl)-1-[3-(triethylammonio)propyl]pyridinium dibromide | ||
|---|---|---|---|---|
| CAS Number | 336185-20-7 | Molecular Weight | 555.43200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H41Br2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 4-((e)-2-[4-(diethylamino)phenyl]ethenyl)-1-[3-(triethylammonio)propyl]pyridinium dibromideFM 2-10 is a fluorescent dye. FM 2-10 is a less hydrophobic version of FM 1-43 (HY-D1434). FM 2-10 can be used for identifying actively firing neurons and investigating the mechanisms of activity-dependent vesicle cycling[1]. |
| Name | 4-((e)-2-[4-(diethylamino)phenyl]ethenyl)-1-[3-(triethylammonio)propyl]pyridinium dibromide |
|---|---|
| Synonym | More Synonyms |
| Description | FM 2-10 is a fluorescent dye. FM 2-10 is a less hydrophobic version of FM 1-43 (HY-D1434). FM 2-10 can be used for identifying actively firing neurons and investigating the mechanisms of activity-dependent vesicle cycling[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H41Br2N3 |
|---|---|
| Molecular Weight | 555.43200 |
| Exact Mass | 553.16700 |
| PSA | 7.12000 |
| InChIKey | HLNKJDYNEWLULB-UHFFFAOYSA-L |
| SMILES | CCN(CC)c1ccc(C=Cc2cc[n+](CCC[N+](CC)(CC)CC)cc2)cc1.[Br-].[Br-] |
| pyridinium,4-[2-[4-(diethylamino)phenyl]ethenyl]-1-[3-(triethylammonio)propyl]-,dibromide |
| n-(3-triethylammoniumpropyl)-4-(4-(diethylamino)styryl)pyridinium dibromide |
| neurodye gh2-10,pure |
| fm(tm) 2-10 |
| gh2-10 |
| neurodye gh-2-10 |
| n-(3-triethylammoniumpropyl)-4-(4-(diethylamino)styryl) pyridinium dibromide [nts2322] fm 2-10 |