sodium O,O-di-sec-butyl dithiophosphate structure
|
Common Name | sodium O,O-di-sec-butyl dithiophosphate | ||
|---|---|---|---|---|
| CAS Number | 33619-92-0 | Molecular Weight | 264.32100 | |
| Density | N/A | Boiling Point | 292.8ºC at 760mmHg | |
| Molecular Formula | C8H18NaO2PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.9ºC | |
| Name | sodium,di(butan-2-yloxy)-sulfanylidene-sulfido-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 292.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C8H18NaO2PS2 |
| Molecular Weight | 264.32100 |
| Flash Point | 130.9ºC |
| Exact Mass | 264.03800 |
| PSA | 60.36000 |
| LogP | 4.03860 |
| InChIKey | FVLCBQUCLOPWGZ-UHFFFAOYSA-M |
| SMILES | CCC(C)OP(=S)([S-])OC(C)CC.[Na+] |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| sodium O,O'-di-s-butyldithiophosphate |
| Phosphorodithioic acid,O,O-di-sec-butyl ester,sodium salt |
| Sodium O,O-di-sec-butyl dithiophosphate |
| EINECS 251-598-7 |
| SODIUM DI-SEC-BUTYL PHOSPHORODITHIOATE |
| Aeroflat 238 |