4-Pyridinamine,2-methoxy-3-nitro- structure
|
Common Name | 4-Pyridinamine,2-methoxy-3-nitro- | ||
|---|---|---|---|---|
| CAS Number | 33623-16-4 | Molecular Weight | 169.13800 | |
| Density | 1.4g/cm3 | Boiling Point | 370.3ºC at 760mmHg | |
| Molecular Formula | C6H7N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.7ºC | |
| Name | 2-methoxy-3-nitropyridin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 370.3ºC at 760mmHg |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.13800 |
| Flash Point | 177.7ºC |
| Exact Mass | 169.04900 |
| PSA | 93.96000 |
| LogP | 1.68500 |
| Index of Refraction | 1.608 |
| InChIKey | XADFTCGTAKIZMI-UHFFFAOYSA-N |
| SMILES | COc1nccc(N)c1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~87%
4-Pyridinamine,... CAS#:33623-16-4 |
| Literature: Deady, Leslie W.; Korytsky, Olga L.; Rowe, Jeffrey E. Australian Journal of Chemistry, 1982 , vol. 35, # 10 p. 2025 - 2034 |
|
~%
4-Pyridinamine,... CAS#:33623-16-4 |
| Literature: Australian Journal of Chemistry, , vol. 35, # 10 p. 2025 - 2034 |
|
~%
4-Pyridinamine,... CAS#:33623-16-4 |
| Literature: Australian Journal of Chemistry, , vol. 35, # 10 p. 2025 - 2034 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Amino-2-methoxy-3-nitropyridin |
| 4-Amino-2-methoxy-3-nitropyridine |
| 2-methoxy-3-nitro-pyridin-4-amine |
| 4-Pyridinamine,2-methoxy-3-nitro |
| 2-methoxy-3-nitro-pyridin-4-ylamine |
| 2-methoxy-3-nitro-4-pyridinamine |