(2Z,4E,6Z,8Z)-N-butyl-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenamide structure
|
Common Name | (2Z,4E,6Z,8Z)-N-butyl-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenamide | ||
|---|---|---|---|---|
| CAS Number | 33631-44-6 | Molecular Weight | 355.55700 | |
| Density | 0.949g/cm3 | Boiling Point | 525.6ºC at 760mmHg | |
| Molecular Formula | C24H37NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324.9ºC | |
| Name | (2Z,4E,6Z,8Z)-N-butyl-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.949g/cm3 |
|---|---|
| Boiling Point | 525.6ºC at 760mmHg |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.55700 |
| Flash Point | 324.9ºC |
| Exact Mass | 355.28800 |
| PSA | 29.10000 |
| LogP | 6.82520 |
| Index of Refraction | 1.532 |
| InChIKey | IOIMWLSSNSWJLN-YVDNJGTBSA-N |
| SMILES | CCCCNC(=O)C=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
|
~%
(2Z,4E,6Z,8Z)-N... CAS#:33631-44-6 |
| Literature: Shealy; Frye; O'Dell; Thorpe; Kirk; Coburn Jr.; Sporn Journal of Pharmaceutical Sciences, 1984 , vol. 73, # 6 p. 745 - 751 |
|
~%
(2Z,4E,6Z,8Z)-N... CAS#:33631-44-6 |
| Literature: Shealy; Frye; O'Dell; Thorpe; Kirk; Coburn Jr.; Sporn Journal of Pharmaceutical Sciences, 1984 , vol. 73, # 6 p. 745 - 751 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Retinoyl amid |
| all-trans-retinamide |
| Vitamin-A-saeure-butylamid |
| all-trans-N-Butylretinamide |
| Retinoyl Amide |
| Vitamin A amide |
| RETINAMIDE |
| Retinamide,all-trans |