N-(2-hydroxyethyl)retinamide structure
|
Common Name | N-(2-hydroxyethyl)retinamide | ||
|---|---|---|---|---|
| CAS Number | 33631-47-9 | Molecular Weight | 343.50300 | |
| Density | 1.013g/cm3 | Boiling Point | 549.1ºC at 760mmHg | |
| Molecular Formula | C22H33NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.9ºC | |
| Name | (2E,4E,6E,8E)-N-(2-hydroxyethyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.013g/cm3 |
|---|---|
| Boiling Point | 549.1ºC at 760mmHg |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.50300 |
| Flash Point | 285.9ºC |
| Exact Mass | 343.25100 |
| PSA | 52.82000 |
| LogP | 5.46680 |
| Index of Refraction | 1.552 |
| InChIKey | JOSHOGBFUULHNI-LYKFAKFTSA-N |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)NCCO |
|
~%
N-(2-hydroxyeth... CAS#:33631-47-9 |
| Literature: Shealy; Frye; O'Dell; Thorpe; Kirk; Coburn Jr.; Sporn Journal of Pharmaceutical Sciences, 1984 , vol. 73, # 6 p. 745 - 751 |
|
~%
N-(2-hydroxyeth... CAS#:33631-47-9 |
| Literature: Campos-Sandoval, Jose Angel; Redondo, Clara; Kinsella, Gemma K.; Pal, Akos; Jones, Geraint; Eyre, Gwen S.; Hirst, Simon C.; Findlay, John B. C. Journal of Medicinal Chemistry, 2011 , vol. 54, # 13 p. 4378 - 4387 |
|
~%
N-(2-hydroxyeth... CAS#:33631-47-9 |
| Literature: Shealy; Frye; O'Dell; Thorpe; Kirk; Coburn Jr.; Sporn Journal of Pharmaceutical Sciences, 1984 , vol. 73, # 6 p. 745 - 751 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-hydroxyethyl all-trans-retinamide |
| Ro 8-4969 |
| Vitamin-A-saeureethanolamid |
| Hydroxyethyl retinamide |
| Retinoic acid 2-hydroxyethylamide |
| 2-Hydroxyethyl retinamide |
| N-2-Hydroxyethyl retinamide |