1,2,3-triphenylpropan-2-ylsulfonylbenzene structure
|
Common Name | 1,2,3-triphenylpropan-2-ylsulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 33641-38-2 | Molecular Weight | 412.54300 | |
| Density | 1.188g/cm3 | Boiling Point | 575ºC at 760 mmHg | |
| Molecular Formula | C27H24O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 348.9ºC | |
| Name | [2-(benzenesulfonyl)-2,3-diphenylpropyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 575ºC at 760 mmHg |
| Molecular Formula | C27H24O2S |
| Molecular Weight | 412.54300 |
| Flash Point | 348.9ºC |
| Exact Mass | 412.15000 |
| PSA | 42.52000 |
| LogP | 6.92200 |
| Index of Refraction | 1.63 |
| InChIKey | HTUMGVKVDVFUGR-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)C(Cc1ccccc1)(Cc1ccccc1)c1ccccc1 |
|
~%
1,2,3-triphenyl... CAS#:33641-38-2 |
| Literature: Kaiser,E.M. et al. Journal of the American Chemical Society, 1971 , vol. 93, # 17 p. 4237 - 4242 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1',1''-[2-(phenylsulfonyl)propane-1,2,3-triyl]tribenzene |