esketamine hydrochloride structure
|
Common Name | esketamine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 33643-47-9 | Molecular Weight | 274.186 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (S)-Ketamine Hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17Cl2NO |
|---|---|
| Molecular Weight | 274.186 |
| Exact Mass | 273.068726 |
| PSA | 29.10000 |
| LogP | 3.28870 |
| InChIKey | VCMGMSHEPQENPE-ZOWNYOTGSA-N |
| SMILES | CNC1(c2ccccc2Cl)CCCCC1=O.Cl |
| HS Code | 2922399090 |
|---|
|
~%
esketamine hydr... CAS#:33643-47-9 |
| Literature: Yokoyama, Reiko; Matsumoto, Satoshi; Nomura, Satoshi; Higaki, Takafumi; Yokoyama, Takeshi; Kiyooka, Syun-ichi Tetrahedron, 2009 , vol. 65, # 27 p. 5181 - 5191 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (1S)-1-(2-Chlorophenyl)-N-methyl-2-oxocyclohexanaminium chloride |
| (S)-2-(2-chlorophenyl)-2-(methylamino)cyclohexanone hydrochloride |
| (S)-ketamine hydrochloride |
| (2S)-2-(2-chlorophenyl)-2-(methylamino)cyclohexan-1-one,hydrochloride |
| Cyclohexanone, 2-(2-chlorophenyl)-2-(methylamino)-, (2S)-, hydrochloride (1:1) |
| esketamine hydrochloride |
| Ketanest S |
| (S)-(+)-Ketamine hydrochloride |
| (2S)-2-(2-chlorophenyl)-2-(methylamino)-cyclohexanone, monohydrochloride |
| (S)-ketamine HCl |
| esketamine HCl |
| (S)-(+)-2-(2-Chlorophenyl)-2-(methylamino)cyclohexanone hydrochloride |
| (S)-2-(o-chlorophenyl)-2-(methylamino)cyclohexanone hydrochloride |