L-Threonine Benzyl Ester Hydrochloride structure
|
Common Name | L-Threonine Benzyl Ester Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 33645-24-8 | Molecular Weight | 245.70300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16ClNO3 | Melting Point | 128.0 to 132.0 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-Threonine Benzyl Ester HydrochlorideH-Thr-Obzl.HCl is a threonine derivative[1]. |
| Name | benzyl (2S,3R)-2-amino-3-hydroxybutanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | H-Thr-Obzl.HCl is a threonine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Melting Point | 128.0 to 132.0 °C |
|---|---|
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.70300 |
| Exact Mass | 245.08200 |
| PSA | 72.55000 |
| LogP | 1.94020 |
| InChIKey | IDZGTFSDZJVMSD-SCYNACPDSA-N |
| SMILES | CC(O)C(N)C(=O)OCc1ccccc1.Cl |
| H-Thr-OBzl.HCl |
| (2S,3R)-Benzyl 2-amino-3-hydroxybutanoate hydrochloride |
| L-Threonine Benzyl Ester Hydrochloride |
| L-Thr-Obzl.HCl |