1,4-bis(4-methylphenyl)piperazine structure
|
Common Name | 1,4-bis(4-methylphenyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 3367-48-4 | Molecular Weight | 266.38100 | |
| Density | 1.067g/cm3 | Boiling Point | 441.6ºC at 760 mmHg | |
| Molecular Formula | C18H22N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.4ºC | |
| Name | 1,4-bis(4-methylphenyl)piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.067g/cm3 |
|---|---|
| Boiling Point | 441.6ºC at 760 mmHg |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.38100 |
| Flash Point | 201.4ºC |
| Exact Mass | 266.17800 |
| PSA | 6.48000 |
| LogP | 3.76000 |
| Index of Refraction | 1.589 |
| InChIKey | STXVIIFFMIFKSD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2CCN(c3ccc(C)cc3)CC2)cc1 |
| HS Code | 2933599090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N,N'-di(p-tolyl)piperazine |
| 1,4-bis(p-tolyl)piperazine |
| 1,4-di-p-tolyl-piperazine |