(R)-2-AMINO-2-(4-NITROPHENYL)ACETIC ACID
Modify Date: 2025-08-25 14:09:48
(R)-2-AMINO-2-(4-NITROPHENYL)ACETIC ACID structure
|
Common Name | (R)-2-AMINO-2-(4-NITROPHENYL)ACETIC ACID | ||
|---|---|---|---|---|
| CAS Number | 336877-75-9 | Molecular Weight | 196.16000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | H-D-Phg(4-NO2)-OH |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8N2O4 |
|---|---|
| Molecular Weight | 196.16000 |
| Exact Mass | 196.04800 |
| PSA | 109.14000 |
| LogP | 1.90270 |
| InChIKey | XCVDAQWKJUCVHJ-SSDOTTSWSA-N |
| SMILES | NC(C(=O)O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (R)-2-Amino-2-(4-nitrophenyl)acetic acid |
| D-4-Nitrophenylglycine |