Flugestone structure
|
Common Name | Flugestone | ||
|---|---|---|---|---|
| CAS Number | 337-03-1 | Molecular Weight | 364.45100 | |
| Density | 1.24g/cm3 | Boiling Point | 526.7ºC at 760mmHg | |
| Molecular Formula | C21H29FO4 | Melting Point | >210°C (dec.) (lit.) | |
| MSDS | N/A | Flash Point | 272.3ºC | |
| Name | (8S,9R,10S,11S,13S,14S,17R)-17-acetyl-9-fluoro-11,17-dihydroxy-10,13-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 526.7ºC at 760mmHg |
| Melting Point | >210°C (dec.) (lit.) |
| Molecular Formula | C21H29FO4 |
| Molecular Weight | 364.45100 |
| Flash Point | 272.3ºC |
| Exact Mass | 364.20500 |
| PSA | 74.60000 |
| LogP | 2.90130 |
| Index of Refraction | 1.565 |
| InChIKey | OFSXGKOMEGSTSE-BPSSIEEOSA-N |
| SMILES | CC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3(F)C(O)CC21C |
|
~%
Flugestone CAS#:337-03-1 |
| Literature: Journal of the American Chemical Society, , vol. 77, p. 1068 |
|
~%
Flugestone CAS#:337-03-1 |
| Literature: Journal of the American Chemical Society, , vol. 77, p. 1068 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Flugestona |
| Flugestonum |
| MFCD01698926 |
| EINECS 206-412-9 |
| Flugestone |