2,2,3,3-Tetrafluoropropanoic anhydride, 2,2,3,3-Tetrafluoropropionic anhydride structure
|
Common Name | 2,2,3,3-Tetrafluoropropanoic anhydride, 2,2,3,3-Tetrafluoropropionic anhydride | ||
|---|---|---|---|---|
| CAS Number | 337-83-7 | Molecular Weight | 274.06600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H2F8O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3-tetrafluoropropanoyl 2,2,3,3-tetrafluoropropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H2F8O3 |
|---|---|
| Molecular Weight | 274.06600 |
| Exact Mass | 273.98800 |
| PSA | 43.37000 |
| LogP | 1.85700 |
| InChIKey | LBGWXMJBOPPNMV-UHFFFAOYSA-N |
| SMILES | O=C(OC(=O)C(F)(F)C(F)F)C(F)(F)C(F)F |
| HS Code | 2915900090 |
|---|
|
~%
2,2,3,3-Tetrafl... CAS#:337-83-7 |
| Literature: Aleinikov, S. F.; Krutikov, V. I.; Lavrent'ev, A. N.; Bakhmutov, Yu. L.; Andreeva, R. K. J. Gen. Chem. USSR (Engl. Transl.), 1983 , vol. 53, # 9 p. 1979 - 1982,1785 - 1788 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 2,2,3,3-tetrafluoro-propionic acid-anhydride |
| 2,2,3,3-Tetrafluoropropanoic anhydride |
| 2,2,3,3-Tetrafluoropropionic anhydride |
| PC8916 |
| 3H-Perfluoropropanoic anhydride |
| Tetrafluor-propionsaeure-anhydrid |
| 2,2,3,3-Tetrafluor-propionsaeureanhydrid |