Benzyl 2-aminobenzoate hydrochloride structure
|
Common Name | Benzyl 2-aminobenzoate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 33708-96-2 | Molecular Weight | 263.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzyl 2-aminobenzoate hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14ClNO2 |
|---|---|
| Molecular Weight | 263.72 |
| InChIKey | JOWGTMCMQJEHTG-UHFFFAOYSA-N |
| SMILES | Cl.Nc1ccccc1C(=O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Benzyl 2-aminobenzoate hydrochloride? |
| A: Molecular formula of Benzyl 2-aminobenzoate hydrochloride is C14H14ClNO2. |
| Q: What is the English name of Benzyl 2-aminobenzoate hydrochloride? |
| A: The English name of Benzyl 2-aminobenzoate hydrochloride is Benzyl 2-aminobenzoate hydrochloride. |
| Q: What is the InChIKey of Benzyl 2-aminobenzoate hydrochloride? |
| A: InChIKey of Benzyl 2-aminobenzoate hydrochloride is JOWGTMCMQJEHTG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Benzyl 2-aminobenzoate hydrochloride? |
| A: Molecular weight of Benzyl 2-aminobenzoate hydrochloride is 263.72. |
| Q: What is the Chinese name of 33708-96-2? |
| A: Chinese name of 33708-96-2 is 33708-96-2. |
| Q: What is the CAS number of Benzyl 2-aminobenzoate hydrochloride? |
| A: CAS number of Benzyl 2-aminobenzoate hydrochloride is 33708-96-2. |
| Q: What is the SMILES notation of Benzyl 2-aminobenzoate hydrochloride? |
| A: SMILES notation of Benzyl 2-aminobenzoate hydrochloride is Cl.Nc1ccccc1C(=O)OCc1ccccc1. |