tris(2-chloropropyl) thiophosphate structure
|
Common Name | tris(2-chloropropyl) thiophosphate | ||
|---|---|---|---|---|
| CAS Number | 33712-72-0 | Molecular Weight | 343.63500 | |
| Density | 1.304g/cm3 | Boiling Point | 357.5ºC at 760mmHg | |
| Molecular Formula | C9H18Cl3O3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170ºC | |
| Name | tris(2-chloropropoxy)-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 357.5ºC at 760mmHg |
| Molecular Formula | C9H18Cl3O3PS |
| Molecular Weight | 343.63500 |
| Flash Point | 170ºC |
| Exact Mass | 341.97800 |
| PSA | 69.59000 |
| LogP | 4.79320 |
| Index of Refraction | 1.5 |
| InChIKey | WWKDGLRDWDSGLU-UHFFFAOYSA-N |
| SMILES | CC(Cl)COP(=S)(OCC(C)Cl)OCC(C)Cl |
| HS Code | 2920190090 |
|---|
|
~%
tris(2-chloropr... CAS#:33712-72-0 |
| Literature: Ethyl Corp. Patent: US2866806 , 1953 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920190090 |
|---|---|
| Summary | 2920190090 other thiophosphoric esters (phosphorothioates) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| einecs 251-651-4 |