3-[1-(2,3-DIMETHOXY-PHENYL)-2-NITRO-ETHYL]-1H-INDOLE structure
|
Common Name | 3-[1-(2,3-DIMETHOXY-PHENYL)-2-NITRO-ETHYL]-1H-INDOLE | ||
|---|---|---|---|---|
| CAS Number | 33723-32-9 | Molecular Weight | 326.34700 | |
| Density | 1.258g/cm3 | Boiling Point | 538.7ºC at 760mmHg | |
| Molecular Formula | C18H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.6ºC | |
| Name | 3-[1-(2,3-dimethoxyphenyl)-2-nitroethyl]-1H-indole |
|---|
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 538.7ºC at 760mmHg |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.34700 |
| Flash Point | 279.6ºC |
| Exact Mass | 326.12700 |
| PSA | 80.07000 |
| LogP | 4.11690 |
| Index of Refraction | 1.626 |
| InChIKey | QSSRNEAHPFPSJZ-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(C[N+](=O)[O-])c2c[nH]c3ccccc23)c1OC |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |