4,7-Dimethyl-2-phenyl-1H-isoindole-1,3(2H)-dione structure
|
Common Name | 4,7-Dimethyl-2-phenyl-1H-isoindole-1,3(2H)-dione | ||
|---|---|---|---|---|
| CAS Number | 33739-66-1 | Molecular Weight | 251.28000 | |
| Density | 1.26g/cm3 | Boiling Point | 433.2ºC at 760 mmHg | |
| Molecular Formula | C16H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.4ºC | |
| Name | 4,7-dimethyl-2-phenylisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 433.2ºC at 760 mmHg |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28000 |
| Flash Point | 201.4ºC |
| Exact Mass | 251.09500 |
| PSA | 37.38000 |
| LogP | 3.16900 |
| Index of Refraction | 1.639 |
| InChIKey | LKYZURGQAADLAM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c2c1C(=O)N(c1ccccc1)C2=O |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-phenyl-3,6-dimethylphthalimide |
| 4,7-dimethyl-2-phenyl-isoindole-1,3-dione |
| 4,7-Dimethyl-2-phenyl-1H-isoindole-1,3(2H)-dione |
| 3,6-dimethyl-N-phenylphthalimide |