1,3-bis(3-amino-2,2-dimethylpropyl)tetrahydro-1H-pyrimidin-2-one structure
|
Common Name | 1,3-bis(3-amino-2,2-dimethylpropyl)tetrahydro-1H-pyrimidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 33739-99-0 | Molecular Weight | 270.41400 | |
| Density | 1.013g/cm3 | Boiling Point | 411ºC at 760mmHg | |
| Molecular Formula | C14H30N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | 1,3-bis(3-amino-2,2-dimethylpropyl)-1,3-diazinan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.013g/cm3 |
|---|---|
| Boiling Point | 411ºC at 760mmHg |
| Molecular Formula | C14H30N4O |
| Molecular Weight | 270.41400 |
| Flash Point | 202.4ºC |
| Exact Mass | 270.24200 |
| PSA | 75.59000 |
| LogP | 2.36030 |
| Index of Refraction | 1.505 |
| InChIKey | LBCVUPDGXGLZNM-UHFFFAOYSA-N |
| SMILES | CC(C)(CN)CN1CCCN(CC(C)(C)CN)C1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 251-664-5 |