N,N-bis(2-chloroethyl)-4-(2-methyl-1,3-thiazol-4-yl)aniline structure
|
Common Name | N,N-bis(2-chloroethyl)-4-(2-methyl-1,3-thiazol-4-yl)aniline | ||
|---|---|---|---|---|
| CAS Number | 33742-56-2 | Molecular Weight | 315.26100 | |
| Density | 1.273g/cm3 | Boiling Point | 460.9ºC at 760 mmHg | |
| Molecular Formula | C14H16Cl2N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.6ºC | |
| Name | N,N-bis(2-chloroethyl)-4-(2-methyl-1,3-thiazol-4-yl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.273g/cm3 |
|---|---|
| Boiling Point | 460.9ºC at 760 mmHg |
| Molecular Formula | C14H16Cl2N2S |
| Molecular Weight | 315.26100 |
| Flash Point | 232.6ºC |
| Exact Mass | 314.04100 |
| PSA | 44.37000 |
| LogP | 4.40250 |
| Index of Refraction | 1.606 |
| InChIKey | KWVTUQYXSXCJSA-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccc(N(CCCl)CCCl)cc2)cs1 |
| HS Code | 2934100090 |
|---|
|
~%
N,N-bis(2-chlor... CAS#:33742-56-2 |
| Literature: Modi,J.D. et al. Journal of Medicinal Chemistry, 1971 , vol. 14, # 9 p. 887 - 888 |
|
~%
N,N-bis(2-chlor... CAS#:33742-56-2 |
| Literature: Modi,J.D. et al. Journal of Medicinal Chemistry, 1971 , vol. 14, # 9 p. 887 - 888 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N,N-bis-(2-chloro-ethyl)-4-(2-methyl-thiazol-4-yl)-aniline |
| 2-Methyl-4-(p-<N,N-bis(2-chlorethyl)-amino>-phenyl)-thiazol |
| Thiazole,4-[4-[bis(2-chloroethyl)amino]phenyl]-2-methyl |