2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid
2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid structure
|
Common Name | 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 33744-31-9 | Molecular Weight | 224.13000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H4N4O5 |
|---|---|
| Molecular Weight | 224.13000 |
| Exact Mass | 224.01800 |
| PSA | 148.77000 |
| InChIKey | INBMIKBNWMSDGM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1nc2c(=O)[nH]c(=O)[nH]c2[nH]c1=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:2577-38-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4,7-Trioxo-1,2,3,4,7,8-hexahydro-pteridin-6-carbonsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid? |
| A: Related downstream products(CAS) of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid: 2577-38-0. |
| Q: What is the molecular formula of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid? |
| A: Molecular formula of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid is C7H4N4O5. |
| Q: What English synonyms does 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid have? |
| A: English synonyms of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid: 2,4,7-Trioxo-1,2,3,4,7,8-hexahydro-pteridin-6-carbonsaeure. |
| Q: What is the InChIKey of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid? |
| A: InChIKey of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid is INBMIKBNWMSDGM-UHFFFAOYSA-N. |
| Q: What is the English name of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid? |
| A: The English name of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid is 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid. |
| Q: What is the Chinese name of 33744-31-9? |
| A: Chinese name of 33744-31-9 is 33744-31-9. |
| Q: What is the molecular weight of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid? |
| A: Molecular weight of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid is 224.13000. |
| Q: What is the CAS number of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid? |
| A: CAS number of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid is 33744-31-9. |
| Q: What is the SMILES notation of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid? |
| A: SMILES notation of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid is O=C(O)c1nc2c(=O)[nH]c(=O)[nH]c2[nH]c1=O. |
| Q: What is the polar surface area (PSA) of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid? |
| A: Polar surface area (PSA) of 2,4,7-trioxo-1,2,3,4,7,8-hexahydro-pteridine-6-carboxylic acid is 148.77000. |