3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide
Modify Date: 2026-07-08 22:18:57
3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide structure
|
Common Name | 3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 33763-79-0 | Molecular Weight | 274.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17Cl2NO |
|---|---|
| Molecular Weight | 274.18 |
| InChIKey | YVMOOCYQIIQIMK-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C)NC(=O)c1ccc(Cl)c(Cl)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide? |
| A: The English name of 3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide is 3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide. |
| Q: What is the InChIKey of 3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide? |
| A: InChIKey of 3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide is YVMOOCYQIIQIMK-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide? |
| A: CAS number of 3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide is 33763-79-0. |
| Q: What is the SMILES notation of 3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide? |
| A: SMILES notation of 3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide is CC(C)CC(C)NC(=O)c1ccc(Cl)c(Cl)c1. |
| Q: What is the molecular weight of 3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide? |
| A: Molecular weight of 3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide is 274.18. |
| Q: What is the Chinese name of 33763-79-0? |
| A: Chinese name of 33763-79-0 is 33763-79-0. |
| Q: What is the molecular formula of 3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide? |
| A: Molecular formula of 3,4-Dichloro-N-(1,3-dimethylbutyl)benzamide is C13H17Cl2NO. |