N-(pivaloyl)ortho-anisidine structure
|
Common Name | N-(pivaloyl)ortho-anisidine | ||
|---|---|---|---|---|
| CAS Number | 33768-49-9 | Molecular Weight | 207.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-(pivaloyl)ortho-anisidine, Chinese name: 对-苯基丙酰氨基苯甲酸, CAS number: 33768-49-9, molecular formula: C12H17NO2, molecular weight: 207.26900, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(pivaloyl)ortho-anisidine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17NO2 |
|---|---|
| Molecular Weight | 207.26900 |
| Exact Mass | 207.12600 |
| PSA | 38.33000 |
| LogP | 2.75280 |
| InChIKey | DEAXWXKYKLQHPE-UHFFFAOYSA-N |
| SMILES | COc1ccccc1NC(=O)C(C)(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 9 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| .2-methoxypivaloylaminobenzene |
| N-(2-methoxy-phenyl)-2,2-dimethyl-propionamide |
| .N-(2-methoxyphenyl)-2,2-dimethyl-propionamide |
| .N-(2-methoxyphenyl)pivalamide |
| .N-(o-methoxyphenyl)pivalamide |
| .N-(2-methoxyphenyl)-2,2-dimethylpropionamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(pivaloyl)ortho-anisidine? |
| A: CAS number of N-(pivaloyl)ortho-anisidine is 33768-49-9. |
| Q: What is the polar surface area (PSA) of N-(pivaloyl)ortho-anisidine? |
| A: Polar surface area (PSA) of N-(pivaloyl)ortho-anisidine is 38.33000. |
| Q: What is the InChIKey of N-(pivaloyl)ortho-anisidine? |
| A: InChIKey of N-(pivaloyl)ortho-anisidine is DEAXWXKYKLQHPE-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N-(pivaloyl)ortho-anisidine? |
| A: Molecular weight of N-(pivaloyl)ortho-anisidine is 207.26900. |
| Q: What is the molecular formula of N-(pivaloyl)ortho-anisidine? |
| A: Molecular formula of N-(pivaloyl)ortho-anisidine is C12H17NO2. |
| Q: What are the downstream products of N-(pivaloyl)ortho-anisidine? |
| A: Related downstream products(CAS) of N-(pivaloyl)ortho-anisidine: 3177-80-8;22614-69-3;56962-00-6;1454-80-4;2236-52-4;5121-34-6;110582-87-1;110582-91-7;115378-20-6. |
| Q: What is the SMILES notation of N-(pivaloyl)ortho-anisidine? |
| A: SMILES notation of N-(pivaloyl)ortho-anisidine is COc1ccccc1NC(=O)C(C)(C)C. |
| Q: What is the LogP of N-(pivaloyl)ortho-anisidine? |
| A: LogP of N-(pivaloyl)ortho-anisidine is 2.75280. |
| Q: What is the English name of N-(pivaloyl)ortho-anisidine? |
| A: The English name of N-(pivaloyl)ortho-anisidine is N-(pivaloyl)ortho-anisidine. |
| Q: What English synonyms does N-(pivaloyl)ortho-anisidine have? |
| A: English synonyms of N-(pivaloyl)ortho-anisidine: .2-methoxypivaloylaminobenzene, N-(2-methoxy-phenyl)-2,2-dimethyl-propionamide, .N-(2-methoxyphenyl)-2,2-dimethyl-propionamide, .N-(2-methoxyphenyl)pivalamide, .N-(o-methoxyphenyl)pivalamide, .N-(2-methoxyphenyl)-2,2-dimethylpropionamide. |