Benzene, 1,2,4,5-tetramethyl-3,6-dineopentyl- structure
|
Common Name | Benzene, 1,2,4,5-tetramethyl-3,6-dineopentyl- | ||
|---|---|---|---|---|
| CAS Number | 33770-83-1 | Molecular Weight | 274.48400 | |
| Density | 0.859g/cm3 | Boiling Point | 356.2ºC at 760 mmHg | |
| Molecular Formula | C20H34 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.6ºC | |
| Name | 1,4-bis(2,2-dimethylpropyl)-2,3,5,6-tetramethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.859g/cm3 |
|---|---|
| Boiling Point | 356.2ºC at 760 mmHg |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.48400 |
| Flash Point | 169.6ºC |
| Exact Mass | 274.26600 |
| LogP | 6.09740 |
| Index of Refraction | 1.49 |
| InChIKey | YRQKLQDETHWVBC-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(CC(C)(C)C)c(C)c(C)c1CC(C)(C)C |
| HS Code | 2902909090 |
|---|
|
~%
Benzene, 1,2,4,... CAS#:33770-83-1 |
| Literature: Newman,M.S. et al. Journal of the American Chemical Society, 1964 , vol. 86, p. 868 - 872 |
|
~%
Benzene, 1,2,4,... CAS#:33770-83-1 |
| Literature: Reuvers,A.J.M. et al. Tetrahedron, 1971 , vol. 27, p. 3713 - 3721 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2902909090 |
|---|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| p-dineopentyltetramethylbenzene |
| 1,4-Dineopentyl-2,3,5,6-tetramethyl-benzol |
| 1.4-Dineopentyltetramethylbenzol |
| Dineopentyldurene |
| 1,4-dineopentyltetramethylbenzene |
| Benzene,1,2,4,5-tetramethyl-3,6-dineopentyl |