2-hydroxy-3-nitro-cyclohepta-2,4,6-trien-1-one structure
|
Common Name | 2-hydroxy-3-nitro-cyclohepta-2,4,6-trien-1-one | ||
|---|---|---|---|---|
| CAS Number | 33776-37-3 | Molecular Weight | 167.11900 | |
| Density | 1.48g/cm3 | Boiling Point | 284.3ºC at 760 mmHg | |
| Molecular Formula | C7H5NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.1ºC | |
| Name | 2-hydroxy-3-nitrocyclohepta-2,4,6-trien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 284.3ºC at 760 mmHg |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.11900 |
| Flash Point | 129.1ºC |
| Exact Mass | 167.02200 |
| PSA | 83.12000 |
| LogP | 1.18380 |
| Index of Refraction | 1.615 |
| InChIKey | OGAMDHXGRUXSBB-UHFFFAOYSA-N |
| SMILES | O=c1ccccc([N+](=O)[O-])c1O |
|
~%
2-hydroxy-3-nit... CAS#:33776-37-3 |
| Literature: Doering; Knox Journal of the American Chemical Society, 1951 , vol. 73, p. 828,838 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-nitro-tropolone |