2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene
Modify Date: 2025-08-26 16:10:00
![2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene Structure](https://www.chemsrc.com/extcaspic/194/3379-46-2.png)
2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene structure
|
Common Name | 2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 3379-46-2 | Molecular Weight | 306.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10N2O5S |
|---|---|
| Molecular Weight | 306.30 |
| InChIKey | HVHWFNLCZPKXKA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)c2c([N+](=O)[O-])cccc2[N+](=O)[O-])cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene? |
| A: SMILES notation of 2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene is Cc1ccc(S(=O)c2c([N+](=O)[O-])cccc2[N+](=O)[O-])cc1. |
| Q: What is the English name of 2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene? |
| A: The English name of 2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene is 2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene. |
| Q: What is the molecular weight of 2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene? |
| A: Molecular weight of 2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene is 306.30. |
| Q: What is the InChIKey of 2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene? |
| A: InChIKey of 2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene is HVHWFNLCZPKXKA-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene? |
| A: Molecular formula of 2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene is C13H10N2O5S. |
| Q: What is the Chinese name of 3379-46-2? |
| A: Chinese name of 3379-46-2 is 3379-46-2. |
| Q: What is the CAS number of 2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene? |
| A: CAS number of 2-[(4-Methylphenyl)sulfinyl]-1,3-dinitrobenzene is 3379-46-2. |