4,4'-isopropylidenebis[2,6-dibromophenyl] diacetate structure
|
Common Name | 4,4'-isopropylidenebis[2,6-dibromophenyl] diacetate | ||
|---|---|---|---|---|
| CAS Number | 33798-02-6 | Molecular Weight | 627.94400 | |
| Density | 1.832g/cm3 | Boiling Point | 530.5ºC at 760mmHg | |
| Molecular Formula | C19H16Br4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.6ºC | |
| Name | 2,2-Propanediylbis-2,6-dibromo-4,1-phenylene diacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.832g/cm3 |
|---|---|
| Boiling Point | 530.5ºC at 760mmHg |
| Molecular Formula | C19H16Br4O4 |
| Molecular Weight | 627.94400 |
| Flash Point | 274.6ºC |
| Exact Mass | 623.77800 |
| PSA | 52.60000 |
| LogP | 6.91310 |
| Index of Refraction | 1.603 |
| InChIKey | ZUBOJXBQSZDOID-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1c(Br)cc(C(C)(C)c2cc(Br)c(OC(C)=O)c(Br)c2)cc1Br |
| HS Code | 2916399090 |
|---|
|
~%
4,4'-isopropyli... CAS#:33798-02-6 |
| Literature: Zincke; Grueters Justus Liebigs Annalen der Chemie, 1905 , vol. 343, p. 88 |
|
~%
4,4'-isopropyli... CAS#:33798-02-6 |
| Literature: Zincke; Grueters Justus Liebigs Annalen der Chemie, 1905 , vol. 343, p. 88 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,2'-bis(4,6-pyrimidinediyl)pyridine-6,6'-diethyl diamide |
| 2,2-Bis-(4-acetoxy-3,5-dibrom-phenyl)-propan |
| 2,2'-bis(4,6-pyrimidinediyl)puridine-6,6'-didiethyl diamide |
| 4,4'-isopropylidenebis(2,6-dibromophenyl) diacetate |
| 2-Pyridinecarboxamide,6,6'-(4,6-pyrimidinediyl)bis[N,N-diethyl |
| 2,2-bis-(4-acetoxy-3,5-dibromo-phenyl)-propane |