2-bromo-1-(4-methoxyphenyl)hexan-1-one
2-bromo-1-(4-methoxyphenyl)hexan-1-one structure
|
Common Name | 2-bromo-1-(4-methoxyphenyl)hexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 33809-55-1 | Molecular Weight | 285.17700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Bromo-1-(4-methoxyphenyl)hexan-1-one (CAS number: 33809-55-1), molecular formula: C13H17BrO2, molecular weight: 285.17700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-bromo-1-(4-methoxyphenyl)hexan-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17BrO2 |
|---|---|
| Molecular Weight | 285.17700 |
| Exact Mass | 284.04100 |
| PSA | 26.30000 |
| LogP | 3.83160 |
| InChIKey | GAQLVKVMOILKSF-UHFFFAOYSA-N |
| SMILES | CCCCC(Br)C(=O)c1ccc(OC)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~89%
2-bromo-1-(4-me... CAS#:33809-55-1 |
| Literature: Mortensen; Rodriguez; Carlson; Sun; Katzenellenbogen Journal of Medicinal Chemistry, 2001 , vol. 44, # 23 p. 3838 - 3848 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-bromo-1-(4-methoxyphenyl)hexan-1-one? |
| A: CAS number of 2-bromo-1-(4-methoxyphenyl)hexan-1-one is 33809-55-1. |
| Q: What is the molecular weight of 2-bromo-1-(4-methoxyphenyl)hexan-1-one? |
| A: Molecular weight of 2-bromo-1-(4-methoxyphenyl)hexan-1-one is 285.17700. |
| Q: What is the InChIKey of 2-bromo-1-(4-methoxyphenyl)hexan-1-one? |
| A: InChIKey of 2-bromo-1-(4-methoxyphenyl)hexan-1-one is GAQLVKVMOILKSF-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 2-bromo-1-(4-methoxyphenyl)hexan-1-one? |
| A: Related upstream materials(CAS) of 2-bromo-1-(4-methoxyphenyl)hexan-1-one: 6397-82-6. |
| Q: What is the LogP of 2-bromo-1-(4-methoxyphenyl)hexan-1-one? |
| A: LogP of 2-bromo-1-(4-methoxyphenyl)hexan-1-one is 3.83160. |
| Q: What is the SMILES notation of 2-bromo-1-(4-methoxyphenyl)hexan-1-one? |
| A: SMILES notation of 2-bromo-1-(4-methoxyphenyl)hexan-1-one is CCCCC(Br)C(=O)c1ccc(OC)cc1. |
| Q: What is the English name of 2-bromo-1-(4-methoxyphenyl)hexan-1-one? |
| A: The English name of 2-bromo-1-(4-methoxyphenyl)hexan-1-one is 2-bromo-1-(4-methoxyphenyl)hexan-1-one. |
| Q: What is the polar surface area (PSA) of 2-bromo-1-(4-methoxyphenyl)hexan-1-one? |
| A: Polar surface area (PSA) of 2-bromo-1-(4-methoxyphenyl)hexan-1-one is 26.30000. |
| Q: What is the Chinese name of 33809-55-1? |
| A: Chinese name of 33809-55-1 is 33809-55-1. |
| Q: What is the molecular formula of 2-bromo-1-(4-methoxyphenyl)hexan-1-one? |
| A: Molecular formula of 2-bromo-1-(4-methoxyphenyl)hexan-1-one is C13H17BrO2. |