ditert-butyl benzene-1,3-dicarboxylate structure
|
Common Name | ditert-butyl benzene-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 33813-32-0 | Molecular Weight | 278.34300 | |
| Density | 1.052g/cm3 | Boiling Point | 346.1ºC at 760mmHg | |
| Molecular Formula | C16H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.5ºC | |
| Name | ditert-butyl benzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.052g/cm3 |
|---|---|
| Boiling Point | 346.1ºC at 760mmHg |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.34300 |
| Flash Point | 162.5ºC |
| Exact Mass | 278.15200 |
| PSA | 52.60000 |
| LogP | 3.59720 |
| Index of Refraction | 1.498 |
| InChIKey | JCBDRGVENJADNA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1cccc(C(=O)OC(C)(C)C)c1 |
| HS Code | 2917399090 |
|---|
|
~%
ditert-butyl be... CAS#:33813-32-0 |
| Literature: Roclofsen,D.P. et al. Recueil des Travaux Chimiques des Pays-Bas, 1970 , vol. 89, p. 193 - 210 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Isophthalsaeure-di-tert.-butylester |
| Di-t-butyl-isophthalat |
| di-tert-butyl isophthalate |