Deprostil
Modify Date: 2025-08-27 11:00:38
Deprostil structure
|
Common Name | Deprostil | ||
|---|---|---|---|---|
| CAS Number | 33813-84-2 | Molecular Weight | 354.52400 | |
| Density | 1.011g/cm3 | Boiling Point | 509.9ºC at 760mmHg | |
| Molecular Formula | C21H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.3ºC | |
| Name | Deprostil |
|---|---|
| Synonym | More Synonyms |
| Density | 1.011g/cm3 |
|---|---|
| Boiling Point | 509.9ºC at 760mmHg |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.52400 |
| Flash Point | 276.3ºC |
| Exact Mass | 354.27700 |
| PSA | 74.60000 |
| LogP | 5.11840 |
| Index of Refraction | 1.485 |
| InChIKey | JERCJPRNXXOPNI-FYQIFJIOSA-N |
| SMILES | CCCCCC(C)(O)CCC1CCC(=O)C1CCCCCCC(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 15-Hydroxy-15-methyl-9-oxoprostan-1-oic acid |
| (1R,2S)-2-(3-Hydroxy-3-methyloctyl)-5-oxocyclopentaneheptanoic acid |
| 15-Hydroxy-15-methyl-9-oxo-prostansaeure |