(6E)-6-[(4-iodoanilino)methylidene]-2-methoxycyclohexa-2,4-dien-1-one structure
|
Common Name | (6E)-6-[(4-iodoanilino)methylidene]-2-methoxycyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 3382-68-1 | Molecular Weight | 353.15500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (6E)-6-[(4-iodoanilino)methylidene]-2-methoxycyclohexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12INO2 |
|---|---|
| Molecular Weight | 353.15500 |
| Exact Mass | 352.99100 |
| PSA | 41.82000 |
| LogP | 3.75600 |
| InChIKey | BTSADZVEHYYJKP-UHFFFAOYSA-N |
| SMILES | COc1cccc(C=Nc2ccc(I)cc2)c1O |
| HS Code | 2925290090 |
|---|
|
~%
(6E)-6-[(4-iodo... CAS#:3382-68-1 |
| Literature: Yaglioglu, Halime G.; Karakas, Asli; Uenver, Hseyin; Elmali, Ayhan Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, 2006 , vol. 61, # 11 p. 1355 - 1360 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N-(2-hydroxy-3-methoxy-benzylidene)-4-iodoaniline |
| N-(2-hydroxy-3-methoxy-benzylidine)-4-iodoaniline |
| 2-[(4-Iodo-phenylimino)-methyl]-6-methoxy-phenol |