N-(3-Nitrobenzylidene)-4-fluoroaniline structure
|
Common Name | N-(3-Nitrobenzylidene)-4-fluoroaniline | ||
|---|---|---|---|---|
| CAS Number | 3382-80-7 | Molecular Weight | 244.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-fluorophenyl)-1-(3-nitrophenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9FN2O2 |
|---|---|
| Molecular Weight | 244.22100 |
| Exact Mass | 244.06500 |
| PSA | 58.18000 |
| LogP | 4.00770 |
| InChIKey | VEQIRTJULHMQCM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(C=Nc2ccc(F)cc2)c1 |
| HS Code | 2925290090 |
|---|
|
~70%
N-(3-Nitrobenzy... CAS#:3382-80-7 |
| Literature: Aggarwal, Nisha; Kumar, Rajesh; Dureja, Prem; Rawat, Diwan S. Journal of Agricultural and Food Chemistry, 2009 , vol. 57, # 18 p. 8520 - 8525 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (4-fluorophenyl)(3-nitrobenzylidene)amine |
| (1E)-1-(4-fluorophenyl)-2-(3-nitrophenyl)-1-azaethene |