2-[(2-chlorophenoxy)methyl]-1H-benzimidazole structure
|
Common Name | 2-[(2-chlorophenoxy)methyl]-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 3384-30-3 | Molecular Weight | 258.70300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(2-chlorophenoxy)methyl]-1H-benzimidazole |
|---|
| Molecular Formula | C14H11ClN2O |
|---|---|
| Molecular Weight | 258.70300 |
| Exact Mass | 258.05600 |
| PSA | 37.91000 |
| LogP | 3.79530 |
| InChIKey | UIPOKFUXNJLYAO-UHFFFAOYSA-N |
| SMILES | Clc1ccccc1OCc1nc2ccccc2[nH]1 |
| HS Code | 2933990090 |
|---|
|
~%
2-[(2-chlorophe... CAS#:3384-30-3 |
| Literature: Wei, Tai-Bao; Hua, Mao-Tang; Shi, Hai-Xiong; Liu, Yong; Zhang, You-Ming Journal of Chemical Research, 2010 , # 8 p. 452 - 454 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |