3-Methyl-6-phenyl-1,2,4-triazine 4-oxide
Modify Date: 2025-09-25 15:56:23
3-Methyl-6-phenyl-1,2,4-triazine 4-oxide structure
|
Common Name | 3-Methyl-6-phenyl-1,2,4-triazine 4-oxide | ||
|---|---|---|---|---|
| CAS Number | 33859-54-0 | Molecular Weight | 187.19800 | |
| Density | 1.22g/cm3 | Boiling Point | 411.8ºC at 760mmHg | |
| Molecular Formula | C10H9N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.8ºC | |
| Name | 3-methyl-4-oxido-6-phenyl-1,2,4-triazin-4-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 411.8ºC at 760mmHg |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.19800 |
| Flash Point | 202.8ºC |
| Exact Mass | 187.07500 |
| PSA | 51.24000 |
| LogP | 1.88050 |
| Index of Refraction | 1.626 |
| InChIKey | BJIXGJNMHUVHDB-UHFFFAOYSA-N |
| SMILES | Cc1nnc(-c2ccccc2)c[n+]1[O-] |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 3-Methyl-6-phenyl-1,2,4-triazine 4-oxide |
| 3-Methyl-6-phenyl-1,2,4-triazin-4-oxid |