N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide
Modify Date: 2026-06-20 14:01:12
![N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide Structure](https://www.chemsrc.com/extcaspic/308/338749-78-3.png)
N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide structure
|
Common Name | N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide | ||
|---|---|---|---|---|
| CAS Number | 338749-78-3 | Molecular Weight | 321.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20ClN3O2 |
|---|---|
| Molecular Weight | 321.8 |
| InChIKey | BJBJLYQOXHUQGU-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)NCC1=CC(=NO1)C2=CC=C(C=C2)Cl |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of compound-pretreated Ebolavirus GP pseudotyped in HIV virions infected i...
Source: ChEMBL
Target: N/A
External Id: CHEMBL2174268
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide? |
| A: Molecular formula of N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide is C16H20ClN3O2. |
| Q: What is the molecular weight of N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide? |
| A: Molecular weight of N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide is 321.8. |
| Q: What is the CAS number of N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide? |
| A: CAS number of N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide is 338749-78-3. |
| Q: What is the SMILES notation of N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide? |
| A: SMILES notation of N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide is CCN(CC)CC(=O)NCC1=CC(=NO1)C2=CC=C(C=C2)Cl. |
| Q: What is the InChIKey of N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide? |
| A: InChIKey of N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide is BJBJLYQOXHUQGU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 338749-78-3? |
| A: Chinese name of 338749-78-3 is 338749-78-3. |
| Q: What is the English name of N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide? |
| A: The English name of N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide is N-{[3-(4-chlorophenyl)-5-isoxazolyl]methyl}-2-(diethylamino)acetamide. |