6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine
6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine structure
|
Common Name | 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine | ||
|---|---|---|---|---|
| CAS Number | 3389-53-5 | Molecular Weight | 189.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine, Chinese name: 6-甲氧基-2-甲硫基-4-嘧啶胺, CAS number: 3389-53-5, molecular formula: C12H15NO, molecular weight: 189.25, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15NO |
|---|---|
| Molecular Weight | 189.25 |
| Exact Mass | 189.115364102 |
| PSA | 86.33000 |
| LogP | 1.37050 |
| InChIKey | UAXRBOBBVNXGMJ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)CC2=CC=CC=C2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-phenylacetyl pyrolidine |
| phenylacetylpyrrolidine |
| 2-phenyl-1-pyrrolidin-1-yl-ethanone |
| phenylacetic pyrrolidine |
| 1-phenylacetylpyrrolidine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine? |
| A: CAS number of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine is 3389-53-5. |
| Q: What is the LogP of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine? |
| A: LogP of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine is 1.37050. |
| Q: What is the polar surface area (PSA) of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine? |
| A: Polar surface area (PSA) of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine is 86.33000. |
| Q: What is the SMILES notation of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine? |
| A: SMILES notation of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine is C1CCN(C1)C(=O)CC2=CC=CC=C2. |
| Q: What is the InChIKey of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine? |
| A: InChIKey of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine is UAXRBOBBVNXGMJ-UHFFFAOYSA-N. |
| Q: What English synonyms does 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine have? |
| A: English synonyms of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine: 1-phenylacetyl pyrolidine, phenylacetylpyrrolidine, 2-phenyl-1-pyrrolidin-1-yl-ethanone, phenylacetic pyrrolidine, 1-phenylacetylpyrrolidine. |
| Q: What is the molecular formula of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine? |
| A: Molecular formula of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine is C12H15NO. |
| Q: What is the molecular weight of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine? |
| A: Molecular weight of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine is 189.25. |
| Q: What is the English name of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine? |
| A: The English name of 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine is 6-Methoxy-2-(methylsulfanyl)-4-pyrimidinamine. |
| Q: What is the Chinese name of 3389-53-5? |
| A: Chinese name of 3389-53-5 is 3389-53-5. |