(3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate
Modify Date: 2026-06-11 12:11:49
(3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate structure
|
Common Name | (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 338960-68-2 | Molecular Weight | 433.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H14Cl2N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H14Cl2N2O5 |
|---|---|
| Molecular Weight | 433.2 |
| InChIKey | ZUWAHSMDEKQNHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)COC(=O)NC3=CC(=CC(=C3)Cl)Cl)[N+](=O)[O-] |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: HepG2-CD81
External Id: CHEMBL4483864
|
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: Plasmodium berghei
External Id: CHEMBL4483863
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate? |
| A: The English name of (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate is (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate. |
| Q: What is the molecular weight of (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate? |
| A: Molecular weight of (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate is 433.2. |
| Q: What is the molecular formula of (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate? |
| A: Molecular formula of (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate is C20H14Cl2N2O5. |
| Q: What is the InChIKey of (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate? |
| A: InChIKey of (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate is ZUWAHSMDEKQNHS-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate? |
| A: SMILES notation of (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate is C1=CC=C(C=C1)OC2=C(C=C(C=C2)COC(=O)NC3=CC(=CC(=C3)Cl)Cl)[N+](=O)[O-]. |
| Q: What is the CAS number of (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate? |
| A: CAS number of (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate is 338960-68-2. |
| Q: What is the Chinese name of 338960-68-2? |
| A: Chinese name of 338960-68-2 is 338960-68-2. |