(3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate
Modify Date: 2026-03-28 11:48:35
(3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate structure
|
Common Name | (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 338960-68-2 | Molecular Weight | 433.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H14Cl2N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-nitro-4-phenoxyphenyl)methyl N-(3,5-dichlorophenyl)carbamate |
|---|
| Molecular Formula | C20H14Cl2N2O5 |
|---|---|
| Molecular Weight | 433.2 |
| InChIKey | ZUWAHSMDEKQNHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)COC(=O)NC3=CC(=CC(=C3)Cl)Cl)[N+](=O)[O-] |
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: HepG2-CD81
External Id: CHEMBL4483864
|
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: Plasmodium berghei
External Id: CHEMBL4483863
|
Total 2, Current Page 1 of 1
1