5-chloro-2-methoxy-n-(2-phenylethyl)benzamide
Modify Date: 2025-08-29 07:45:27
5-chloro-2-methoxy-n-(2-phenylethyl)benzamide structure
|
Common Name | 5-chloro-2-methoxy-n-(2-phenylethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 33924-49-1 | Molecular Weight | 289.75700 | |
| Density | 1.192g/cm3 | Boiling Point | 439ºC at 760mmHg | |
| Molecular Formula | C16H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.3ºC | |
| Name | 5-chloro-2-methoxy-n-(2-phenylethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 439ºC at 760mmHg |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.75700 |
| Flash Point | 219.3ºC |
| Exact Mass | 289.08700 |
| PSA | 38.33000 |
| LogP | 3.71200 |
| Index of Refraction | 1.577 |
| InChIKey | MTPTUMXFGUUUSZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-phenethyl-5-chloro-2-methoxybenzamide |
| 5-chloro-2-methoxy-N-(2-phenylethyl)-benzamide |
| N-Phenethyl-5-chlor-2-methoxy-benzamid |