9-Octadecenoic acid (9Z)-,esters,monoester with triglycerol structure
|
Common Name | 9-Octadecenoic acid (9Z)-,esters,monoester with triglycerol | ||
|---|---|---|---|---|
| CAS Number | 33940-98-6 | Molecular Weight | 504.697 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 636.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C27H52O8 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 196.5±25.0 °C | |
| Name | 9-Octadecenoic acid (9Z)-,esters,monoester with triglycerol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 636.0±55.0 °C at 760 mmHg |
| Molecular Formula | C27H52O8 |
| Molecular Weight | 504.697 |
| Flash Point | 196.5±25.0 °C |
| Exact Mass | 504.366211 |
| LogP | 5.94 |
| Vapour Pressure | 0.0±4.3 mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | SJLAFUFWXUJDDR-KTKRTIGZSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(O)COCC(O)COCC(O)CO |
| RIDADR | NONH for all modes of transport |
|---|
| 9-Octadecenoic acid, 3-[3-(2,3-dihydroxypropoxy)-2-hydroxypropoxy]-2-hydroxypropyl ester, (9Z)- |
| 3-[3-(2,3-Dihydroxypropoxy)-2-hydroxypropoxy]-2-hydroxypropyl (9Z)-9-octadecenoate |