4-(2-Hydroxy-3-isopropylaminopropoxy)benzoic Acid Methyl Ester Hydrochloride structure
|
Common Name | 4-(2-Hydroxy-3-isopropylaminopropoxy)benzoic Acid Methyl Ester Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 33947-96-5 | Molecular Weight | 303.78200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]benzoate,hydrochloride |
|---|
| Molecular Formula | C14H22ClNO4 |
|---|---|
| Molecular Weight | 303.78200 |
| Exact Mass | 303.12400 |
| PSA | 67.79000 |
| LogP | 2.40380 |
| InChIKey | TYCFNOCRTIAJQV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OCC(O)CNC(C)C)cc1.Cl |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |