[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-trimethyl-azanium structure
|
Common Name | [4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-trimethyl-azanium | ||
|---|---|---|---|---|
| CAS Number | 33949-42-7 | Molecular Weight | 260.76700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H21ClN6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-trimethylazanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H21ClN6 |
|---|---|
| Molecular Weight | 260.76700 |
| Exact Mass | 260.15200 |
| PSA | 45.15000 |
| InChIKey | GNGLREBSHXMDAQ-UHFFFAOYSA-M |
| SMILES | CN(C)c1nc(N(C)C)nc([N+](C)(C)C)n1.[Cl-] |
|
~%
[4,6-bis(dimeth... CAS#:33949-42-7 |
| Literature: Rushton, Philip; Stevens, Malcolm F. G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1533 - 1540 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4,6-bisdimethylamino-sym-triazinyl-2-trimethylammonium chloride |
| N-<4,6-bis(dimethylamino)-1,3,5-triazin-2-yl>trimethylammonium chloride |