Methyl 8-isopimaren-18-oate structure
|
Common Name | Methyl 8-isopimaren-18-oate | ||
|---|---|---|---|---|
| CAS Number | 33952-78-2 | Molecular Weight | 318.49300 | |
| Density | 1g/cm3 | Boiling Point | 385.3ºC at 760 mmHg | |
| Molecular Formula | C21H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.2ºC | |
| Name | methyl 7-ethyl-1,4a,7-trimethyl-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 385.3ºC at 760 mmHg |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.49300 |
| Flash Point | 181.2ºC |
| Exact Mass | 318.25600 |
| PSA | 26.30000 |
| LogP | 5.66270 |
| Index of Refraction | 1.51 |
| InChIKey | LZUSHGHGVLPXFI-UHFFFAOYSA-N |
| SMILES | CCC1(C)CCC2=C(CCC3C(C)(C(=O)OC)CCCC23C)C1 |
|
~%
Methyl 8-isopim... CAS#:33952-78-2 |
| Literature: Carman,R.M.; Craig,W.J. Australian Journal of Chemistry, 1971 , vol. 24, p. 2379 - 2388 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (13S)-pimar-8-en-18-oic acid methyl ester |
| (13S)-Pimar-8-en-18-saeure-methylester |