1-amino-2-chloro-4-p-toluidino-anthraquinone
Modify Date: 2025-08-27 10:47:08
1-amino-2-chloro-4-p-toluidino-anthraquinone structure
|
Common Name | 1-amino-2-chloro-4-p-toluidino-anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 33966-23-3 | Molecular Weight | 362.80900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-amino-2-chloro-4-p-toluidino-anthraquinone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H15ClN2O2 |
|---|---|
| Molecular Weight | 362.80900 |
| Exact Mass | 362.08200 |
| PSA | 72.19000 |
| LogP | 5.40380 |
| InChIKey | BCIUGPADOHRZJL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2cc(Cl)c(N)c3c2C(=O)c2ccccc2C3=O)cc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-AMINO-2-CHLORO-4-PARA-TOLYLAMINO-ANTHRAQUINONE |
| 1-Amino-2-chlor-4-p-toluidino-[9.10]anthrachinon |
| 1-Amino-2-chlor-4-p-toluidino-anthrachinon |