4'-Amino-3-2'-azotoluene structure
|
Common Name | 4'-Amino-3-2'-azotoluene | ||
|---|---|---|---|---|
| CAS Number | 3398-09-2 | Molecular Weight | 225.28900 | |
| Density | 1.09 g/cm3 | Boiling Point | 409.8ºC at 760mmHg | |
| Molecular Formula | C14H15N3 | Melting Point | 80ºC | |
| MSDS | N/A | Flash Point | 201.6ºC | |
| Name | 3-methyl-4-[(3-methylphenyl)diazenyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09 g/cm3 |
|---|---|
| Boiling Point | 409.8ºC at 760mmHg |
| Melting Point | 80ºC |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.28900 |
| Flash Point | 201.6ºC |
| Exact Mass | 225.12700 |
| PSA | 50.74000 |
| LogP | 4.88220 |
| Index of Refraction | 1.593 |
| InChIKey | IVUQHXKKRQEFBU-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N=Nc2ccc(N)cc2C)c1 |
| HS Code | 2927000090 |
|---|
|
~%
4'-Amino-3-2'-a... CAS#:3398-09-2 |
| Literature: BASF SE; BACHER, Jean-Pierre; DE KEYZER, Gerardus; LEHMANN, Urs Patent: WO2011/157614 A1, 2011 ; Location in patent: Page/Page column 37 ; |
|
~%
4'-Amino-3-2'-a... CAS#:3398-09-2 |
| Literature: Parsons; Bailar Journal of the American Chemical Society, 1936 , vol. 58, p. 268,270 |
|
~%
4'-Amino-3-2'-a... CAS#:3398-09-2 |
| Literature: Earl; Robson Austral.chem.Inst.J.Pr., 1939 , vol. 6, p. 268,273 |
|
~%
4'-Amino-3-2'-a... CAS#:3398-09-2 |
| Literature: Mehner Journal fuer Praktische Chemie (Leipzig), 1902 , vol. <2>65, p. 462 |
|
~%
4'-Amino-3-2'-a... CAS#:3398-09-2 |
| Literature: Nietzki Chemische Berichte, 1877 , vol. 10, p. 1155 |
|
~%
Detail
|
| Literature: Mehner Journal fuer Praktische Chemie (Leipzig), 1902 , vol. <2>65, p. 462 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| m-Toluol-azo-m-toluidin |
| Fast Garnet GC Base |
| EINECS 222-262-7 |
| 4'-Amino-3-2'-azotoluene |
| 4-Amino-2.3'-dimethyl-azobenzol |
| p-Dimethylamineazobenzol |
| 4-Amino-2':3-azotoluene |
| 4-m-Tolylazo-m-toluidine |
| 6-m-Toluolazo-3-amino-toluol |
| 3-methyl-4-m-tolylazo-aniline |